C34H42N4O6 — CID 142882142
ethane;3-methoxy-5-[4-[[4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol (PubChem CID 142882142) has the molecular formula C34H42N4O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is ethane;3-methoxy-5-[4-[[4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol.
| Compound Name | ethane;3-methoxy-5-[4-[[4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 142882142 |
| Molecular Formula | C34H42N4O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | ethane;3-methoxy-5-[4-[[4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol |
| SMILES | CC.COc1cc(-c2cc(CN3CCN(Cc4ccnc(-c5cc(OC)c(OC)c(OC)c5)c4)CC3)ccn2)cc(O)c1O |
| InChI | InChI=1S/C32H36N4O6.C2H6/c1-39-28-16-23(15-27(37)31(28)38)25-13-21(5-7-33-25)19-35-9-11-36(12-10-35)20-22-6-8-34-26(14-22)24-17-29(40-2)32(42-4)30(18-24)41-3;1-2/h5-8,13-18,37-38H,9-12,19-20H2,1-4H3;1-2H3 |
| InChIKey | GNNMGZSFEJRURR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|