C22H30N2O4 — CID 142818332
ethane;1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-one (PubChem CID 142818332) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is ethane;1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-one.
| Compound Name | ethane;1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-one |
|---|---|
| PubChem CID | 142818332 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | ethane;1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-one |
| SMILES | CC.COc1cc(-c2cc(CN3CCC(=O)CC3)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N2O4.C2H6/c1-24-18-11-15(12-19(25-2)20(18)26-3)17-10-14(4-7-21-17)13-22-8-5-16(23)6-9-22;1-2/h4,7,10-12H,5-6,8-9,13H2,1-3H3;1-2H3 |
| InChIKey | KBLIUCTXUJPDQS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |