C30H37N3O3 — CID 18546847
1-[(E)-5-phenylpent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine (PubChem CID 18546847) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is 1-[(E)-5-phenylpent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine.
| Compound Name | 1-[(E)-5-phenylpent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 18546847 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 1-[(E)-5-phenylpent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine |
| SMILES | COc1cc(-c2cc(CN3CCN(CCC/C=C/c4ccccc4)CC3)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C30H37N3O3/c1-34-28-21-26(22-29(35-2)30(28)36-3)27-20-25(13-14-31-27)23-33-18-16-32(17-19-33)15-9-5-8-12-24-10-6-4-7-11-24/h4,6-8,10-14,20-22H,5,9,15-19,23H2,1-3H3/b12-8+ |
| InChIKey | DNZMEMYIVJFMFF-XYOKQWHBSA-N |
| XLogP | 5.39 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|