C21H28N2O3 — CID 21338831
4-[(4-methylpiperidin-1-yl)methyl]-2-(3,4,5-trimethoxyphenyl)pyridine (PubChem CID 21338831) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-[(4-methylpiperidin-1-yl)methyl]-2-(3,4,5-trimethoxyphenyl)pyridine.
| Compound Name | 4-[(4-methylpiperidin-1-yl)methyl]-2-(3,4,5-trimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 21338831 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 4-[(4-methylpiperidin-1-yl)methyl]-2-(3,4,5-trimethoxyphenyl)pyridine |
| SMILES | COc1cc(-c2cc(CN3CCC(C)CC3)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C21H28N2O3/c1-15-6-9-23(10-7-15)14-16-5-8-22-18(11-16)17-12-19(24-2)21(26-4)20(13-17)25-3/h5,8,11-13,15H,6-7,9-10,14H2,1-4H3 |
| InChIKey | UOKYXBYQCLYDLO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |