C23H30N2O — CID 142906227
2-(3-cyclopropyl-5-methoxy-4-methylphenyl)-4-[(4-methylpiperidin-1-yl)methyl]pyridine (PubChem CID 142906227) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-(3-cyclopropyl-5-methoxy-4-methylphenyl)-4-[(4-methylpiperidin-1-yl)methyl]pyridine.
| Compound Name | 2-(3-cyclopropyl-5-methoxy-4-methylphenyl)-4-[(4-methylpiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 142906227 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-(3-cyclopropyl-5-methoxy-4-methylphenyl)-4-[(4-methylpiperidin-1-yl)methyl]pyridine |
| SMILES | COc1cc(-c2cc(CN3CCC(C)CC3)ccn2)cc(C2CC2)c1C |
| InChI | InChI=1S/C23H30N2O/c1-16-7-10-25(11-8-16)15-18-6-9-24-22(12-18)20-13-21(19-4-5-19)17(2)23(14-20)26-3/h6,9,12-14,16,19H,4-5,7-8,10-11,15H2,1-3H3 |
| InChIKey | LSAUWWHQFRJERX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |