C44H48N4O4 — CID 142818250
5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]anilino]piperidin-1-yl]methyl]-2-pyridinyl]-3-cyclopropylbenzene-1,2-diol (PubChem CID 142818250) has the molecular formula C44H48N4O4 and a molecular weight of 696.89 g/mol. Its IUPAC name is 5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]anilino]piperidin-1-yl]methyl]-2-pyridinyl]-3-cyclopropylbenzene-1,2-diol.
| Compound Name | 5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]anilino]piperidin-1-yl]methyl]-2-pyridinyl]-3-cyclopropylbenzene-1,2-diol |
|---|---|
| PubChem CID | 142818250 |
| Molecular Formula | C44H48N4O4 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 696.37 |
| IUPAC Name | 5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]anilino]piperidin-1-yl]methyl]-2-pyridinyl]-3-cyclopropylbenzene-1,2-diol |
| SMILES | COc1cc(-c2cc(CN(c3ccccc3)C3CCN(Cc4ccnc(-c5cc(O)c(O)c(C6CC6)c5)c4)CC3)ccn2)cc(C2CCC2)c1OC |
| InChI | InChI=1S/C44H48N4O4/c1-51-42-26-34(24-38(44(42)52-2)31-7-6-8-31)40-22-30(14-18-46-40)28-48(35-9-4-3-5-10-35)36-15-19-47(20-16-36)27-29-13-17-45-39(21-29)33-23-37(32-11-12-32)43(50)41(49)25-33/h3-5,9-10,13-14,17-18,21-26,31-32,36,49-50H,6-8,11-12,15-16,19-20,27-28H2,1-2H3 |
| InChIKey | VVFBGLCVOFRHQB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|