C45H50N4O6 — CID 142818290
3-cyclobutyl-5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dihydroxyphenyl)-4-pyridinyl]methyl]-2,3-dimethoxyanilino]piperidin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol (PubChem CID 142818290) has the molecular formula C45H50N4O6 and a molecular weight of 742.92 g/mol. Its IUPAC name is 3-cyclobutyl-5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dihydroxyphenyl)-4-pyridinyl]methyl]-2,3-dimethoxyanilino]piperidin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol.
| Compound Name | 3-cyclobutyl-5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dihydroxyphenyl)-4-pyridinyl]methyl]-2,3-dimethoxyanilino]piperidin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 142818290 |
| Molecular Formula | C45H50N4O6 |
| Molecular Weight | 742.92 g/mol |
| Exact Mass | 742.37 |
| IUPAC Name | 3-cyclobutyl-5-[4-[[4-[N-[[2-(3-cyclobutyl-4,5-dihydroxyphenyl)-4-pyridinyl]methyl]-2,3-dimethoxyanilino]piperidin-1-yl]methyl]-2-pyridinyl]benzene-1,2-diol |
| SMILES | COc1cccc(N(Cc2ccnc(-c3cc(O)c(O)c(C4CCC4)c3)c2)C2CCN(Cc3ccnc(-c4cc(O)c(O)c(C5CCC5)c4)c3)CC2)c1OC |
| InChI | InChI=1S/C45H50N4O6/c1-54-42-11-5-10-39(45(42)55-2)49(27-29-13-17-47-38(21-29)33-23-36(31-8-4-9-31)44(53)41(51)25-33)34-14-18-48(19-15-34)26-28-12-16-46-37(20-28)32-22-35(30-6-3-7-30)43(52)40(50)24-32/h5,10-13,16-17,20-25,30-31,34,50-53H,3-4,6-9,14-15,18-19,26-27H2,1-2H3 |
| InChIKey | DVAOJSRSDOHZMV-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.92 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|