C30H36FN3O3 — CID 18546820
1-[(E)-5-(4-fluorophenyl)pent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine (PubChem CID 18546820) has the molecular formula C30H36FN3O3 and a molecular weight of 505.63 g/mol. Its IUPAC name is 1-[(E)-5-(4-fluorophenyl)pent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine.
| Compound Name | 1-[(E)-5-(4-fluorophenyl)pent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 18546820 |
| Molecular Formula | C30H36FN3O3 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 1-[(E)-5-(4-fluorophenyl)pent-4-enyl]-4-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperazine |
| SMILES | COc1cc(-c2cc(CN3CCN(CCC/C=C/c4ccc(F)cc4)CC3)ccn2)cc(OC)c1OC |
| InChI | InChI=1S/C30H36FN3O3/c1-35-28-20-25(21-29(36-2)30(28)37-3)27-19-24(12-13-32-27)22-34-17-15-33(16-18-34)14-6-4-5-7-23-8-10-26(31)11-9-23/h5,7-13,19-21H,4,6,14-18,22H2,1-3H3/b7-5+ |
| InChIKey | LDNZYRBOLAAOBY-FNORWQNLSA-N |
| XLogP | 5.52 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|