C21H24F2N2 — CID 138460328
1-[(E)-4-(4-fluorophenyl)but-3-enyl]-4-[(4-fluorophenyl)methyl]piperazine (PubChem CID 138460328) has the molecular formula C21H24F2N2 and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-[(E)-4-(4-fluorophenyl)but-3-enyl]-4-[(4-fluorophenyl)methyl]piperazine.
| Compound Name | 1-[(E)-4-(4-fluorophenyl)but-3-enyl]-4-[(4-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 138460328 |
| Molecular Formula | C21H24F2N2 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(E)-4-(4-fluorophenyl)but-3-enyl]-4-[(4-fluorophenyl)methyl]piperazine |
| SMILES | Fc1ccc(/C=C/CCN2CCN(Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H24F2N2/c22-20-8-4-18(5-9-20)3-1-2-12-24-13-15-25(16-14-24)17-19-6-10-21(23)11-7-19/h1,3-11H,2,12-17H2/b3-1+ |
| InChIKey | WEECYUZNENFXIM-HNQUOIGGSA-N |
| XLogP | 4.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |