C32H40F2N2O3 — CID 10187118
1-[6,6-bis(4-fluorophenyl)hexyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 10187118) has the molecular formula C32H40F2N2O3 and a molecular weight of 538.68 g/mol. Its IUPAC name is 1-[6,6-bis(4-fluorophenyl)hexyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[6,6-bis(4-fluorophenyl)hexyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 10187118 |
| Molecular Formula | C32H40F2N2O3 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | 1-[6,6-bis(4-fluorophenyl)hexyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(CN2CCN(CCCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C32H40F2N2O3/c1-37-30-21-24(22-31(38-2)32(30)39-3)23-36-19-17-35(18-20-36)16-6-4-5-7-29(25-8-12-27(33)13-9-25)26-10-14-28(34)15-11-26/h8-15,21-22,29H,4-7,16-20,23H2,1-3H3 |
| InChIKey | FSLMXULFVDTVHG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|