C33H52N2O6 — CID 15227840
1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-1,4-diazepane (PubChem CID 15227840) has the molecular formula C33H52N2O6 and a molecular weight of 572.79 g/mol. Its IUPAC name is 1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-1,4-diazepane.
| Compound Name | 1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-1,4-diazepane |
|---|---|
| PubChem CID | 15227840 |
| Molecular Formula | C33H52N2O6 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | 1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-1,4-diazepane |
| SMILES | COc1cc(CCCCCN2CCCN(CCCCCc3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C33H52N2O6/c1-36-28-22-26(23-29(37-2)32(28)40-5)14-9-7-11-16-34-18-13-19-35(21-20-34)17-12-8-10-15-27-24-30(38-3)33(41-6)31(25-27)39-4/h22-25H,7-21H2,1-6H3 |
| InChIKey | VOUJHNQTTYQAEK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|