C33H48N2O6 — CID 71305037
1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-5H-1,4-diazepine (PubChem CID 71305037) has the molecular formula C33H48N2O6 and a molecular weight of 568.76 g/mol. Its IUPAC name is 1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-5H-1,4-diazepine.
| Compound Name | 1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-5H-1,4-diazepine |
|---|---|
| PubChem CID | 71305037 |
| Molecular Formula | C33H48N2O6 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | 1,4-bis[5-(3,4,5-trimethoxyphenyl)pentyl]-5H-1,4-diazepine |
| SMILES | COc1cc(CCCCCN2C=CCN(CCCCCc3cc(OC)c(OC)c(OC)c3)C=C2)cc(OC)c1OC |
| InChI | InChI=1S/C33H48N2O6/c1-36-28-22-26(23-29(37-2)32(28)40-5)14-9-7-11-16-34-18-13-19-35(21-20-34)17-12-8-10-15-27-24-30(38-3)33(41-6)31(25-27)39-4/h13,18,20-25H,7-12,14-17,19H2,1-6H3 |
| InChIKey | QSWFBQRVARTDBJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|