C19H31BrO3 — CID 156501832
5-(10-bromodecyl)-1,2,3-trimethoxybenzene (PubChem CID 156501832) has the molecular formula C19H31BrO3 and a molecular weight of 387.36 g/mol. Its IUPAC name is 5-(10-bromodecyl)-1,2,3-trimethoxybenzene.
| Compound Name | 5-(10-bromodecyl)-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 156501832 |
| Molecular Formula | C19H31BrO3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 5-(10-bromodecyl)-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(CCCCCCCCCCBr)cc(OC)c1OC |
| InChI | InChI=1S/C19H31BrO3/c1-21-17-14-16(15-18(22-2)19(17)23-3)12-10-8-6-4-5-7-9-11-13-20/h14-15H,4-13H2,1-3H3 |
| InChIKey | IJKXAFLZARURIS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|