C20H33BrO3 — CID 156502087
4-(10-bromodecyl)-1,2,3-trimethoxy-5-methylbenzene (PubChem CID 156502087) has the molecular formula C20H33BrO3 and a molecular weight of 401.39 g/mol. Its IUPAC name is 4-(10-bromodecyl)-1,2,3-trimethoxy-5-methylbenzene.
| Compound Name | 4-(10-bromodecyl)-1,2,3-trimethoxy-5-methylbenzene |
|---|---|
| PubChem CID | 156502087 |
| Molecular Formula | C20H33BrO3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-(10-bromodecyl)-1,2,3-trimethoxy-5-methylbenzene |
| SMILES | COc1cc(C)c(CCCCCCCCCCBr)c(OC)c1OC |
| InChI | InChI=1S/C20H33BrO3/c1-16-15-18(22-2)20(24-4)19(23-3)17(16)13-11-9-7-5-6-8-10-12-14-21/h15H,5-14H2,1-4H3 |
| InChIKey | YNFTTXNAUAEUHQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|