C13H20O3 — CID 117322234
3-(2,4-dimethoxy-3,6-dimethylphenyl)propan-1-ol (PubChem CID 117322234) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(2,4-dimethoxy-3,6-dimethylphenyl)propan-1-ol.
| Compound Name | 3-(2,4-dimethoxy-3,6-dimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117322234 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-(2,4-dimethoxy-3,6-dimethylphenyl)propan-1-ol |
| SMILES | COc1cc(C)c(CCCO)c(OC)c1C |
| InChI | InChI=1S/C13H20O3/c1-9-8-12(15-3)10(2)13(16-4)11(9)6-5-7-14/h8,14H,5-7H2,1-4H3 |
| InChIKey | CEPNQSKTDKSCEF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |