C12H17FO4 — CID 117362411
3-(2-fluoro-3,5,6-trimethoxyphenyl)propan-1-ol (PubChem CID 117362411) has the molecular formula C12H17FO4 and a molecular weight of 244.26 g/mol. Its IUPAC name is 3-(2-fluoro-3,5,6-trimethoxyphenyl)propan-1-ol.
| Compound Name | 3-(2-fluoro-3,5,6-trimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117362411 |
| Molecular Formula | C12H17FO4 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-(2-fluoro-3,5,6-trimethoxyphenyl)propan-1-ol |
| SMILES | COc1cc(OC)c(OC)c(CCCO)c1F |
| InChI | InChI=1S/C12H17FO4/c1-15-9-7-10(16-2)12(17-3)8(11(9)13)5-4-6-14/h7,14H,4-6H2,1-3H3 |
| InChIKey | XNXRLUOFYLDTSA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |