C11H16O2 — CID 130125367
(3-methoxy-2,5,6-trimethylphenyl)methanol (PubChem CID 130125367) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3-methoxy-2,5,6-trimethylphenyl)methanol.
| Compound Name | (3-methoxy-2,5,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 130125367 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3-methoxy-2,5,6-trimethylphenyl)methanol |
| SMILES | COc1cc(C)c(C)c(CO)c1C |
| InChI | InChI=1S/C11H16O2/c1-7-5-11(13-4)9(3)10(6-12)8(7)2/h5,12H,6H2,1-4H3 |
| InChIKey | DOISGSZHRSWTGJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |