C10H13BrO2 — CID 84802792
(3-bromo-6-methoxy-2,4-dimethylphenyl)methanol (PubChem CID 84802792) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is (3-bromo-6-methoxy-2,4-dimethylphenyl)methanol.
| Compound Name | (3-bromo-6-methoxy-2,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 84802792 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | (3-bromo-6-methoxy-2,4-dimethylphenyl)methanol |
| SMILES | COc1cc(C)c(Br)c(C)c1CO |
| InChI | InChI=1S/C10H13BrO2/c1-6-4-9(13-3)8(5-12)7(2)10(6)11/h4,12H,5H2,1-3H3 |
| InChIKey | ICCLVKGNAFIWLQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |