About 3-bromo-6-methoxy-2,4-dimethylbenzonitrile
3-bromo-6-methoxy-2,4-dimethylbenzonitrile (PubChem CID 50883121) has the molecular formula C10H10BrNO
and a molecular weight of 240.10 g/mol. Its IUPAC name is 3-bromo-6-methoxy-2,4-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 3-bromo-6-methoxy-2,4-dimethylbenzonitrile |
| PubChem CID | 50883121 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 3-bromo-6-methoxy-2,4-dimethylbenzonitrile |
| SMILES | COc1cc(C)c(Br)c(C)c1C#N |
| InChI | InChI=1S/C10H10BrNO/c1-6-4-9(13-3)8(5-12)7(2)10(6)11/h4H,1-3H3 |
| InChIKey | DUFZCSHEUIEPDT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-6-methoxy-2,4-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-methoxy-2,4-dimethylbenzonitrile?
The IUPAC name of 3-bromo-6-methoxy-2,4-dimethylbenzonitrile (CID 50883121) is 3-bromo-6-methoxy-2,4-dimethylbenzonitrile.
What is the SMILES notation for 3-bromo-6-methoxy-2,4-dimethylbenzonitrile?
The canonical SMILES for 3-bromo-6-methoxy-2,4-dimethylbenzonitrile is COc1cc(C)c(Br)c(C)c1C#N.
What is the InChIKey of 3-bromo-6-methoxy-2,4-dimethylbenzonitrile?
The InChIKey is DUFZCSHEUIEPDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO/c1-6-4-9(13-3)8(5-12)7(2)10(6)11/h4H,1-3H3.
What are the key properties of 3-bromo-6-methoxy-2,4-dimethylbenzonitrile?
3-bromo-6-methoxy-2,4-dimethylbenzonitrile has a molecular weight of 240.10 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-methoxy-2,4-dimethylbenzonitrile is sourced from PubChem (CID 50883121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).