C10H11NO2 — CID 11435258
2,4-dimethoxy-6-methylbenzonitrile (PubChem CID 11435258) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2,4-dimethoxy-6-methylbenzonitrile.
| Compound Name | 2,4-dimethoxy-6-methylbenzonitrile |
|---|---|
| PubChem CID | 11435258 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2,4-dimethoxy-6-methylbenzonitrile |
| SMILES | COc1cc(C)c(C#N)c(OC)c1 |
| InChI | InChI=1S/C10H11NO2/c1-7-4-8(12-2)5-10(13-3)9(7)6-11/h4-5H,1-3H3 |
| InChIKey | SGXRDFSVDJBEAU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |