C9H15NO3 — CID 172746341
2,4-dimethoxy-6-methylaniline;hydrate (PubChem CID 172746341) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2,4-dimethoxy-6-methylaniline;hydrate.
| Compound Name | 2,4-dimethoxy-6-methylaniline;hydrate |
|---|---|
| PubChem CID | 172746341 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2,4-dimethoxy-6-methylaniline;hydrate |
| SMILES | COc1cc(C)c(N)c(OC)c1.O |
| InChI | InChI=1S/C9H13NO2.H2O/c1-6-4-7(11-2)5-8(12-3)9(6)10;/h4-5H,10H2,1-3H3;1H2 |
| InChIKey | DZSNEGIDMDPRNI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|