C9H14ClNO2 — CID 91663006
3,5-dimethoxy-2-methylaniline;hydrochloride (PubChem CID 91663006) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is 3,5-dimethoxy-2-methylaniline;hydrochloride.
| Compound Name | 3,5-dimethoxy-2-methylaniline;hydrochloride |
|---|---|
| PubChem CID | 91663006 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3,5-dimethoxy-2-methylaniline;hydrochloride |
| SMILES | COc1cc(N)c(C)c(OC)c1.Cl |
| InChI | InChI=1S/C9H13NO2.ClH/c1-6-8(10)4-7(11-2)5-9(6)12-3;/h4-5H,10H2,1-3H3;1H |
| InChIKey | JKUCWHZYHFVJKU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|