C9H11FO2 — CID 22970635
1-fluoro-3,5-dimethoxy-2-methylbenzene (PubChem CID 22970635) has the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. Its IUPAC name is 1-fluoro-3,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-fluoro-3,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 22970635 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1-fluoro-3,5-dimethoxy-2-methylbenzene |
| SMILES | COc1cc(F)c(C)c(OC)c1 |
| InChI | InChI=1S/C9H11FO2/c1-6-8(10)4-7(11-2)5-9(6)12-3/h4-5H,1-3H3 |
| InChIKey | ZYVIESMWPIWIDY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |