C26H31NO6 — CID 102009274
3,5-dimethyl-2,6-bis(2,4,6-trimethoxyphenyl)aniline (PubChem CID 102009274) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3,5-dimethyl-2,6-bis(2,4,6-trimethoxyphenyl)aniline.
| Compound Name | 3,5-dimethyl-2,6-bis(2,4,6-trimethoxyphenyl)aniline |
|---|---|
| PubChem CID | 102009274 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 3,5-dimethyl-2,6-bis(2,4,6-trimethoxyphenyl)aniline |
| SMILES | COc1cc(OC)c(-c2c(C)cc(C)c(-c3c(OC)cc(OC)cc3OC)c2N)c(OC)c1 |
| InChI | InChI=1S/C26H31NO6/c1-14-9-15(2)23(25-20(32-7)12-17(29-4)13-21(25)33-8)26(27)22(14)24-18(30-5)10-16(28-3)11-19(24)31-6/h9-13H,27H2,1-8H3 |
| InChIKey | IOGWKIOBDSEROI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|