C13H15NO3 — CID 116868995
5-(2,4-dimethoxy-6-methylphenyl)-3-methyl-1,2-oxazole (PubChem CID 116868995) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-(2,4-dimethoxy-6-methylphenyl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(2,4-dimethoxy-6-methylphenyl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 116868995 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5-(2,4-dimethoxy-6-methylphenyl)-3-methyl-1,2-oxazole |
| SMILES | COc1cc(C)c(-c2cc(C)no2)c(OC)c1 |
| InChI | InChI=1S/C13H15NO3/c1-8-5-10(15-3)7-11(16-4)13(8)12-6-9(2)14-17-12/h5-7H,1-4H3 |
| InChIKey | FXXKUMIHXGLHPN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |