C22H21N3O3 — CID 135912239
2,5-bis(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)-1H-pyrrol-3-amine (PubChem CID 135912239) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2,5-bis(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)-1H-pyrrol-3-amine.
| Compound Name | 2,5-bis(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)-1H-pyrrol-3-amine |
|---|---|
| PubChem CID | 135912239 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2,5-bis(4-methoxyphenyl)-4-(3-methyl-1,2-oxazol-5-yl)-1H-pyrrol-3-amine |
| SMILES | COc1ccc(-c2[nH]c(-c3ccc(OC)cc3)c(-c3cc(C)no3)c2N)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-13-12-18(28-25-13)19-20(23)22(15-6-10-17(27-3)11-7-15)24-21(19)14-4-8-16(26-2)9-5-14/h4-12,24H,23H2,1-3H3 |
| InChIKey | GCXNKDHFABQPKB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |