C10H10N2OS2 — CID 28805707
5-amino-4-(4-methoxyphenyl)-3H-1,3-thiazole-2-thione (PubChem CID 28805707) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is 5-amino-4-(4-methoxyphenyl)-3H-1,3-thiazole-2-thione.
| Compound Name | 5-amino-4-(4-methoxyphenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 28805707 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-amino-4-(4-methoxyphenyl)-3H-1,3-thiazole-2-thione |
| SMILES | COc1ccc(-c2[nH]c(=S)sc2N)cc1 |
| InChI | InChI=1S/C10H10N2OS2/c1-13-7-4-2-6(3-5-7)8-9(11)15-10(14)12-8/h2-5H,11H2,1H3,(H,12,14) |
| InChIKey | RHSHFCOYCXNTOK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|