C38H28O2S3 — CID 132513911
2,5-bis[5-[4-(4-methoxyphenyl)phenyl]thiophen-2-yl]thiophene (PubChem CID 132513911) has the molecular formula C38H28O2S3 and a molecular weight of 612.84 g/mol. Its IUPAC name is 2,5-bis[5-[4-(4-methoxyphenyl)phenyl]thiophen-2-yl]thiophene.
| Compound Name | 2,5-bis[5-[4-(4-methoxyphenyl)phenyl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 132513911 |
| Molecular Formula | C38H28O2S3 |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 2,5-bis[5-[4-(4-methoxyphenyl)phenyl]thiophen-2-yl]thiophene |
| SMILES | COc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7ccc(OC)cc7)cc6)s5)s4)s3)cc2)cc1 |
| InChI | InChI=1S/C38H28O2S3/c1-39-31-15-11-27(12-16-31)25-3-7-29(8-4-25)33-19-21-35(41-33)37-23-24-38(43-37)36-22-20-34(42-36)30-9-5-26(6-10-30)28-13-17-32(40-2)18-14-28/h3-24H,1-2H3 |
| InChIKey | OFGNUUQYRGAZRW-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |