C34H24O2S3 — CID 102235498
2,5-bis[5-(6-methoxynaphthalen-2-yl)thiophen-2-yl]thiophene (PubChem CID 102235498) has the molecular formula C34H24O2S3 and a molecular weight of 560.77 g/mol. Its IUPAC name is 2,5-bis[5-(6-methoxynaphthalen-2-yl)thiophen-2-yl]thiophene.
| Compound Name | 2,5-bis[5-(6-methoxynaphthalen-2-yl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 102235498 |
| Molecular Formula | C34H24O2S3 |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | 2,5-bis[5-(6-methoxynaphthalen-2-yl)thiophen-2-yl]thiophene |
| SMILES | COc1ccc2cc(-c3ccc(-c4ccc(-c5ccc(-c6ccc7cc(OC)ccc7c6)s5)s4)s3)ccc2c1 |
| InChI | InChI=1S/C34H24O2S3/c1-35-27-9-7-21-17-25(5-3-23(21)19-27)29-11-13-31(37-29)33-15-16-34(39-33)32-14-12-30(38-32)26-6-4-24-20-28(36-2)10-8-22(24)18-26/h3-20H,1-2H3 |
| InChIKey | LQPLLQQHZVASOM-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |