C30H24O2S — CID 16751334
2,5-bis[4-(4-methoxyphenyl)phenyl]thiophene (PubChem CID 16751334) has the molecular formula C30H24O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2,5-bis[4-(4-methoxyphenyl)phenyl]thiophene.
| Compound Name | 2,5-bis[4-(4-methoxyphenyl)phenyl]thiophene |
|---|---|
| PubChem CID | 16751334 |
| Molecular Formula | C30H24O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2,5-bis[4-(4-methoxyphenyl)phenyl]thiophene |
| SMILES | COc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(OC)cc5)cc4)s3)cc2)cc1 |
| InChI | InChI=1S/C30H24O2S/c1-31-27-15-11-23(12-16-27)21-3-7-25(8-4-21)29-19-20-30(33-29)26-9-5-22(6-10-26)24-13-17-28(32-2)18-14-24/h3-20H,1-2H3 |
| InChIKey | LDOCJKVYPPDZJW-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |