C18H14F2O2S — CID 141443240
2-(2,3-difluoro-4-methoxyphenyl)-5-(4-methoxyphenyl)thiophene (PubChem CID 141443240) has the molecular formula C18H14F2O2S and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-methoxyphenyl)-5-(4-methoxyphenyl)thiophene.
| Compound Name | 2-(2,3-difluoro-4-methoxyphenyl)-5-(4-methoxyphenyl)thiophene |
|---|---|
| PubChem CID | 141443240 |
| Molecular Formula | C18H14F2O2S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-(2,3-difluoro-4-methoxyphenyl)-5-(4-methoxyphenyl)thiophene |
| SMILES | COc1ccc(-c2ccc(-c3ccc(OC)c(F)c3F)s2)cc1 |
| InChI | InChI=1S/C18H14F2O2S/c1-21-12-5-3-11(4-6-12)15-9-10-16(23-15)13-7-8-14(22-2)18(20)17(13)19/h3-10H,1-2H3 |
| InChIKey | SPVCMPHLJYUIJK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |