C8H7NOS2 — CID 11401345
6-methoxy-3H-1,3-benzothiazole-2-thione (PubChem CID 11401345) has the molecular formula C8H7NOS2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 6-methoxy-3H-1,3-benzothiazole-2-thione.
| Compound Name | 6-methoxy-3H-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 11401345 |
| Molecular Formula | C8H7NOS2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 6-methoxy-3H-1,3-benzothiazole-2-thione |
| SMILES | COc1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C8H7NOS2/c1-10-5-2-3-6-7(4-5)12-8(11)9-6/h2-4H,1H3,(H,9,11) |
| InChIKey | WBKYNVBTKLKJBG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|