C13H20N2S2 — CID 160864917
3H-1,3-benzothiazole-2-thione;hexan-1-amine (PubChem CID 160864917) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;hexan-1-amine.
| Compound Name | 3H-1,3-benzothiazole-2-thione;hexan-1-amine |
|---|---|
| PubChem CID | 160864917 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;hexan-1-amine |
| SMILES | CCCCCCN.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C6H15N/c9-7-8-5-3-1-2-4-6(5)10-7;1-2-3-4-5-6-7/h1-4H,(H,8,9);2-7H2,1H3 |
| InChIKey | SKZDCEBGIKCGLG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|