C7H5N4S2- — CID 157106263
3H-1,3-benzothiazole-2-thione azide (PubChem CID 157106263) has the molecular formula C7H5N4S2- and a molecular weight of 209.28 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione azide.
| Compound Name | 3H-1,3-benzothiazole-2-thione azide |
|---|---|
| PubChem CID | 157106263 |
| Molecular Formula | C7H5N4S2- |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione azide |
| SMILES | S=c1[nH]c2ccccc2s1.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C7H5NS2.N3/c9-7-8-5-3-1-2-4-6(5)10-7;1-3-2/h1-4H,(H,8,9);/q;-1 |
| InChIKey | AGIJLMLQHXGMJW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|