C15H23NOS2 — CID 138698492
3H-1,3-benzothiazole-2-thione;2-methyl-1-(2-methylpropoxy)propane (PubChem CID 138698492) has the molecular formula C15H23NOS2 and a molecular weight of 297.49 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;2-methyl-1-(2-methylpropoxy)propane.
| Compound Name | 3H-1,3-benzothiazole-2-thione;2-methyl-1-(2-methylpropoxy)propane |
|---|---|
| PubChem CID | 138698492 |
| Molecular Formula | C15H23NOS2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;2-methyl-1-(2-methylpropoxy)propane |
| SMILES | CC(C)COCC(C)C.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C8H18O.C7H5NS2/c1-7(2)5-9-6-8(3)4;9-7-8-5-3-1-2-4-6(5)10-7/h7-8H,5-6H2,1-4H3;1-4H,(H,8,9) |
| InChIKey | SKEFSXUOYYTRCC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|