C15H24N2S2 — CID 3034709
3H-1,3-benzothiazole-2-thione;N-butylbutan-1-amine (PubChem CID 3034709) has the molecular formula C15H24N2S2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;N-butylbutan-1-amine.
| Compound Name | 3H-1,3-benzothiazole-2-thione;N-butylbutan-1-amine |
|---|---|
| PubChem CID | 3034709 |
| Molecular Formula | C15H24N2S2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;N-butylbutan-1-amine |
| SMILES | CCCCNCCCC.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C8H19N.C7H5NS2/c1-3-5-7-9-8-6-4-2;9-7-8-5-3-1-2-4-6(5)10-7/h9H,3-8H2,1-2H3;1-4H,(H,8,9) |
| InChIKey | BKSICYWQMAIZGY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|