About 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione
3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione (PubChem CID 88526850) has the molecular formula C10H11N3S3
and a molecular weight of 269.42 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione |
| PubChem CID | 88526850 |
| Molecular Formula | C10H11N3S3 |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione |
| SMILES | S=C1NCCN1.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C3H6N2S/c9-7-8-5-3-1-2-4-6(5)10-7;6-3-4-1-2-5-3/h1-4H,(H,8,9);1-2H2,(H2,4,5,6) |
| InChIKey | DSBYCRWMRRBYMP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione (CID 88526850) is 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione is S=C1NCCN1.S=c1[nH]c2ccccc2s1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione?
The InChIKey is DSBYCRWMRRBYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C3H6N2S/c9-7-8-5-3-1-2-4-6(5)10-7;6-3-4-1-2-5-3/h1-4H,(H,8,9);1-2H2,(H2,4,5,6).
What are the key properties of 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione?
3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione has a molecular weight of 269.42 g/mol, XLogP of 2.42, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione is sourced from PubChem (CID 88526850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).