C10H11N3S3 — CID 88526850
3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione (PubChem CID 88526850) has the molecular formula C10H11N3S3 and a molecular weight of 269.42 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione.
| Compound Name | 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione |
|---|---|
| PubChem CID | 88526850 |
| Molecular Formula | C10H11N3S3 |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;imidazolidine-2-thione |
| SMILES | S=C1NCCN1.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C3H6N2S/c9-7-8-5-3-1-2-4-6(5)10-7;6-3-4-1-2-5-3/h1-4H,(H,8,9);1-2H2,(H2,4,5,6) |
| InChIKey | DSBYCRWMRRBYMP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|