C7H8N2S — CID 14118883
2,3-dihydro-1,3-benzothiazol-2-amine (PubChem CID 14118883) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 2,3-dihydro-1,3-benzothiazol-2-amine.
| Compound Name | 2,3-dihydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 14118883 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 2,3-dihydro-1,3-benzothiazol-2-amine |
| SMILES | NC1Nc2ccccc2S1 |
| InChI | InChI=1S/C7H8N2S/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4,7,9H,8H2 |
| InChIKey | PVOBHWZVXBTENP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |