About 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid
3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid (PubChem CID 88673041) has the molecular formula C10H13NO3S3
and a molecular weight of 291.42 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid |
| PubChem CID | 88673041 |
| Molecular Formula | C10H13NO3S3 |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid |
| SMILES | CC(C)S(=O)(=O)O.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C3H8O3S/c9-7-8-5-3-1-2-4-6(5)10-7;1-3(2)7(4,5)6/h1-4H,(H,8,9);3H,1-2H3,(H,4,5,6) |
| InChIKey | FKDALGKIRKFEDH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid (CID 88673041) is 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid is CC(C)S(=O)(=O)O.S=c1[nH]c2ccccc2s1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid?
The InChIKey is FKDALGKIRKFEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C3H8O3S/c9-7-8-5-3-1-2-4-6(5)10-7;1-3(2)7(4,5)6/h1-4H,(H,8,9);3H,1-2H3,(H,4,5,6).
What are the key properties of 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid?
3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid has a molecular weight of 291.42 g/mol, XLogP of 3.24, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid is sourced from PubChem (CID 88673041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).