C10H13NO3S3 — CID 88673041
3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid (PubChem CID 88673041) has the molecular formula C10H13NO3S3 and a molecular weight of 291.42 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid.
| Compound Name | 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid |
|---|---|
| PubChem CID | 88673041 |
| Molecular Formula | C10H13NO3S3 |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;propane-2-sulfonic acid |
| SMILES | CC(C)S(=O)(=O)O.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C3H8O3S/c9-7-8-5-3-1-2-4-6(5)10-7;1-3(2)7(4,5)6/h1-4H,(H,8,9);3H,1-2H3,(H,4,5,6) |
| InChIKey | FKDALGKIRKFEDH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|