C7H5NS2Zr+4 — CID 158478024
3H-1,3-benzothiazole-2-thione;zirconium(4+) (PubChem CID 158478024) has the molecular formula C7H5NS2Zr+4 and a molecular weight of 258.48 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;zirconium(4+).
| Compound Name | 3H-1,3-benzothiazole-2-thione;zirconium(4+) |
|---|---|
| PubChem CID | 158478024 |
| Molecular Formula | C7H5NS2Zr+4 |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 256.89 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;zirconium(4+) |
| SMILES | S=c1[nH]c2ccccc2s1.[Zr+4] |
| InChI | InChI=1S/C7H5NS2.Zr/c9-7-8-5-3-1-2-4-6(5)10-7;/h1-4H,(H,8,9);/q;+4 |
| InChIKey | HHEGWQJLNNYARK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|