C13H9NS2 — CID 22057660
6-phenyl-3H-1,3-benzothiazole-2-thione (PubChem CID 22057660) has the molecular formula C13H9NS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is 6-phenyl-3H-1,3-benzothiazole-2-thione.
| Compound Name | 6-phenyl-3H-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 22057660 |
| Molecular Formula | C13H9NS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 6-phenyl-3H-1,3-benzothiazole-2-thione |
| SMILES | S=c1[nH]c2ccc(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C13H9NS2/c15-13-14-11-7-6-10(8-12(11)16-13)9-4-2-1-3-5-9/h1-8H,(H,14,15) |
| InChIKey | MOMXPQZJSAEPOU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|