C14H11N3S3 — CID 836716
1-phenyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)thiourea (PubChem CID 836716) has the molecular formula C14H11N3S3 and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-phenyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)thiourea.
| Compound Name | 1-phenyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)thiourea |
|---|---|
| PubChem CID | 836716 |
| Molecular Formula | C14H11N3S3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 1-phenyl-3-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)thiourea |
| SMILES | S=C(Nc1ccccc1)Nc1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C14H11N3S3/c18-13(15-9-4-2-1-3-5-9)16-10-6-7-11-12(8-10)20-14(19)17-11/h1-8H,(H,17,19)(H2,15,16,18) |
| InChIKey | PXMPNRFOTDLVBL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|