C25H36N2OS2 — CID 54181411
N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)octadeca-9,12-dienamide (PubChem CID 54181411) has the molecular formula C25H36N2OS2 and a molecular weight of 444.71 g/mol. Its IUPAC name is N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)octadeca-9,12-dienamide.
| Compound Name | N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 54181411 |
| Molecular Formula | C25H36N2OS2 |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)Nc1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C25H36N2OS2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(28)26-21-18-19-22-23(20-21)30-25(29)27-22/h6-7,9-10,18-20H,2-5,8,11-17H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | PCBMTRCDSWYSQB-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|