C35H49NO5 — CID 121307788
[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl] 2-hydroxy-5-(octanoylamino)benzoate (PubChem CID 121307788) has the molecular formula C35H49NO5 and a molecular weight of 563.78 g/mol. Its IUPAC name is [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl] 2-hydroxy-5-(octanoylamino)benzoate.
| Compound Name | [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl] 2-hydroxy-5-(octanoylamino)benzoate |
|---|---|
| PubChem CID | 121307788 |
| Molecular Formula | C35H49NO5 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | [(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl] 2-hydroxy-5-(octanoylamino)benzoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(=O)c1cc(NC(=O)CCCCCCC)ccc1O |
| InChI | InChI=1S/C35H49NO5/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-26-34(39)41-35(40)31-29-30(27-28-32(31)37)36-33(38)25-23-21-8-6-4-2/h5,7,10-11,13-14,16-17,19-20,27-29,37H,3-4,6,8-9,12,15,18,21-26H2,1-2H3,(H,36,38)/b7-5-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | ZAFBATGJXBCLEH-GJCLIZKUSA-N |
| XLogP | 9.30 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|