C44H70O6 — CID 141297968
bis[(Z)-octadec-9-enoyl] benzene-1,4-dicarboxylate (PubChem CID 141297968) has the molecular formula C44H70O6 and a molecular weight of 695.04 g/mol. Its IUPAC name is bis[(Z)-octadec-9-enoyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[(Z)-octadec-9-enoyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 141297968 |
| Molecular Formula | C44H70O6 |
| Molecular Weight | 695.04 g/mol |
| Exact Mass | 694.52 |
| IUPAC Name | bis[(Z)-octadec-9-enoyl] benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)c1ccc(C(=O)OC(=O)CCCCCCC/C=C\CCCCCCCC)cc1 |
| InChI | InChI=1S/C44H70O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(45)49-43(47)39-35-37-40(38-36-39)44(48)50-42(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,35-38H,3-16,21-34H2,1-2H3/b19-17-,20-18- |
| InChIKey | YKRCJZHYAQOZBD-CLFAGFIQSA-N |
| XLogP | 13.13 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.04 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|