C15H10N4S — CID 107788676
1-(3,4-dicyanophenyl)-3-phenylthiourea (PubChem CID 107788676) has the molecular formula C15H10N4S and a molecular weight of 278.34 g/mol. Its IUPAC name is 1-(3,4-dicyanophenyl)-3-phenylthiourea.
| Compound Name | 1-(3,4-dicyanophenyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 107788676 |
| Molecular Formula | C15H10N4S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-(3,4-dicyanophenyl)-3-phenylthiourea |
| SMILES | N#Cc1ccc(NC(=S)Nc2ccccc2)cc1C#N |
| InChI | InChI=1S/C15H10N4S/c16-9-11-6-7-14(8-12(11)10-17)19-15(20)18-13-4-2-1-3-5-13/h1-8H,(H2,18,19,20) |
| InChIKey | XGQHONBIHGENNC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|