C16H12N4O — CID 107791441
N-(3,4-dicyanophenyl)-2-(methylamino)benzamide (PubChem CID 107791441) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)-2-(methylamino)benzamide.
| Compound Name | N-(3,4-dicyanophenyl)-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 107791441 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(3,4-dicyanophenyl)-2-(methylamino)benzamide |
| SMILES | CNc1ccccc1C(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C16H12N4O/c1-19-15-5-3-2-4-14(15)16(21)20-13-7-6-11(9-17)12(8-13)10-18/h2-8,19H,1H3,(H,20,21) |
| InChIKey | RSKXJIUJFSYOHQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |