C16H11N3OS — CID 107794528
N-(3,4-dicyanophenyl)-2-methyl-5-sulfanylbenzamide (PubChem CID 107794528) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(3,4-dicyanophenyl)-2-methyl-5-sulfanylbenzamide.
| Compound Name | N-(3,4-dicyanophenyl)-2-methyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107794528 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(3,4-dicyanophenyl)-2-methyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C16H11N3OS/c1-10-2-5-14(21)7-15(10)16(20)19-13-4-3-11(8-17)12(6-13)9-18/h2-7,21H,1H3,(H,19,20) |
| InChIKey | DOGIJQAMIILRFC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|