C15H8BrN3OS — CID 107794539
2-bromo-N-(3,4-dicyanophenyl)-5-sulfanylbenzamide (PubChem CID 107794539) has the molecular formula C15H8BrN3OS and a molecular weight of 358.22 g/mol. Its IUPAC name is 2-bromo-N-(3,4-dicyanophenyl)-5-sulfanylbenzamide.
| Compound Name | 2-bromo-N-(3,4-dicyanophenyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107794539 |
| Molecular Formula | C15H8BrN3OS |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 2-bromo-N-(3,4-dicyanophenyl)-5-sulfanylbenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(S)ccc2Br)cc1C#N |
| InChI | InChI=1S/C15H8BrN3OS/c16-14-4-3-12(21)6-13(14)15(20)19-11-2-1-9(7-17)10(5-11)8-18/h1-6,21H,(H,19,20) |
| InChIKey | GWZYGGZQMQQSEN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|