C15H14BrNO3S — CID 107020368
2-bromo-N-(3,4-dimethoxyphenyl)-5-sulfanylbenzamide (PubChem CID 107020368) has the molecular formula C15H14BrNO3S and a molecular weight of 368.25 g/mol. Its IUPAC name is 2-bromo-N-(3,4-dimethoxyphenyl)-5-sulfanylbenzamide.
| Compound Name | 2-bromo-N-(3,4-dimethoxyphenyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107020368 |
| Molecular Formula | C15H14BrNO3S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 2-bromo-N-(3,4-dimethoxyphenyl)-5-sulfanylbenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(S)ccc2Br)cc1OC |
| InChI | InChI=1S/C15H14BrNO3S/c1-19-13-6-3-9(7-14(13)20-2)17-15(18)11-8-10(21)4-5-12(11)16/h3-8,21H,1-2H3,(H,17,18) |
| InChIKey | MWSBHVLLLXAMKK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|